C14H11N3O7 — CID 165364462
1-methyl-3,5-dinitro-2-[(4-nitrophenyl)methoxy]benzene (PubChem CID 165364462) has the molecular formula C14H11N3O7 and a molecular weight of 333.26 g/mol. Its IUPAC name is 1-methyl-3,5-dinitro-2-[(4-nitrophenyl)methoxy]benzene.
| Compound Name | 1-methyl-3,5-dinitro-2-[(4-nitrophenyl)methoxy]benzene |
|---|---|
| PubChem CID | 165364462 |
| Molecular Formula | C14H11N3O7 |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 1-methyl-3,5-dinitro-2-[(4-nitrophenyl)methoxy]benzene |
| SMILES | Cc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H11N3O7/c1-9-6-12(16(20)21)7-13(17(22)23)14(9)24-8-10-2-4-11(5-3-10)15(18)19/h2-7H,8H2,1H3 |
| InChIKey | PJAYOGJNCCFVBQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 138.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|