C14H16N2O6 — CID 14207567
3-(2,4-dinitro-6-propan-2-ylphenyl)pentane-2,4-dione (PubChem CID 14207567) has the molecular formula C14H16N2O6 and a molecular weight of 308.29 g/mol. Its IUPAC name is 3-(2,4-dinitro-6-propan-2-ylphenyl)pentane-2,4-dione.
| Compound Name | 3-(2,4-dinitro-6-propan-2-ylphenyl)pentane-2,4-dione |
|---|---|
| PubChem CID | 14207567 |
| Molecular Formula | C14H16N2O6 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 3-(2,4-dinitro-6-propan-2-ylphenyl)pentane-2,4-dione |
| SMILES | CC(=O)C(C(C)=O)c1c(C(C)C)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H16N2O6/c1-7(2)11-5-10(15(19)20)6-12(16(21)22)14(11)13(8(3)17)9(4)18/h5-7,13H,1-4H3 |
| InChIKey | UHPOUYRLFRBIFE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 120.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|