C17H11N5O10 — CID 89366286
(3R)-3-[(2,4,5,7-tetranitrofluoren-9-ylidene)amino]oxybutan-2-one (PubChem CID 89366286) has the molecular formula C17H11N5O10 and a molecular weight of 445.30 g/mol. Its IUPAC name is (3R)-3-[(2,4,5,7-tetranitrofluoren-9-ylidene)amino]oxybutan-2-one.
| Compound Name | (3R)-3-[(2,4,5,7-tetranitrofluoren-9-ylidene)amino]oxybutan-2-one |
|---|---|
| PubChem CID | 89366286 |
| Molecular Formula | C17H11N5O10 |
| Molecular Weight | 445.30 g/mol |
| Exact Mass | 445.05 |
| IUPAC Name | (3R)-3-[(2,4,5,7-tetranitrofluoren-9-ylidene)amino]oxybutan-2-one |
| SMILES | CC(=O)[C@@H](C)ON=C1c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2-c2c1cc([N+](=O)[O-])cc2[N+](=O)[O-] |
| InChI | InChI=1S/C17H11N5O10/c1-7(23)8(2)32-18-17-11-3-9(19(24)25)5-13(21(28)29)15(11)16-12(17)4-10(20(26)27)6-14(16)22(30)31/h3-6,8H,1-2H3/t8-/m1/s1 |
| InChIKey | YMWFWDRHRUCNPV-MRVPVSSYSA-N |
| XLogP | 3.05 |
| TPSA | 211.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|