C23H22N6O11 — CID 102531130
[2-hydroxy-3-[3-[(2,4,5,7-tetranitrofluoren-9-ylidene)amino]propylamino]propyl] 2-methylprop-2-enoate (PubChem CID 102531130) has the molecular formula C23H22N6O11 and a molecular weight of 558.46 g/mol. Its IUPAC name is [2-hydroxy-3-[3-[(2,4,5,7-tetranitrofluoren-9-ylidene)amino]propylamino]propyl] 2-methylprop-2-enoate.
| Compound Name | [2-hydroxy-3-[3-[(2,4,5,7-tetranitrofluoren-9-ylidene)amino]propylamino]propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 102531130 |
| Molecular Formula | C23H22N6O11 |
| Molecular Weight | 558.46 g/mol |
| Exact Mass | 558.13 |
| IUPAC Name | [2-hydroxy-3-[3-[(2,4,5,7-tetranitrofluoren-9-ylidene)amino]propylamino]propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)CNCCCN=C1c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2-c2c1cc([N+](=O)[O-])cc2[N+](=O)[O-] |
| InChI | InChI=1S/C23H22N6O11/c1-12(2)23(31)40-11-15(30)10-24-4-3-5-25-22-16-6-13(26(32)33)8-18(28(36)37)20(16)21-17(22)7-14(27(34)35)9-19(21)29(38)39/h6-9,15,24,30H,1,3-5,10-11H2,2H3 |
| InChIKey | HTERUWSMRFKCQV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 243.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.46 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|