C23H39NO6 — CID 159679404
[(E)-2-hydroxy-12-[[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl]amino]dodec-8-enyl] 2-methylprop-2-enoate (PubChem CID 159679404) has the molecular formula C23H39NO6 and a molecular weight of 425.57 g/mol. Its IUPAC name is [(E)-2-hydroxy-12-[[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl]amino]dodec-8-enyl] 2-methylprop-2-enoate.
| Compound Name | [(E)-2-hydroxy-12-[[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl]amino]dodec-8-enyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 159679404 |
| Molecular Formula | C23H39NO6 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.28 |
| IUPAC Name | [(E)-2-hydroxy-12-[[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl]amino]dodec-8-enyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)CCCCC/C=C/CCCNCC(O)COC(=O)C(=C)C |
| InChI | InChI=1S/C23H39NO6/c1-18(2)22(27)29-16-20(25)13-11-9-7-5-6-8-10-12-14-24-15-21(26)17-30-23(28)19(3)4/h6,8,20-21,24-26H,1,3,5,7,9-17H2,2,4H3/b8-6+ |
| InChIKey | MFDSDVJZVJHZPX-SOFGYWHQSA-N |
| XLogP | 2.82 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|