C24H39NO3 — CID 91064879
(2-ethyloctadeca-9,12,15-trienoylamino) 2-methylprop-2-enoate (PubChem CID 91064879) has the molecular formula C24H39NO3 and a molecular weight of 389.58 g/mol. Its IUPAC name is (2-ethyloctadeca-9,12,15-trienoylamino) 2-methylprop-2-enoate.
| Compound Name | (2-ethyloctadeca-9,12,15-trienoylamino) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 91064879 |
| Molecular Formula | C24H39NO3 |
| Molecular Weight | 389.58 g/mol |
| Exact Mass | 389.29 |
| IUPAC Name | (2-ethyloctadeca-9,12,15-trienoylamino) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)ONC(=O)C(CC)CCCCCCC=CCC=CCC=CCC |
| InChI | InChI=1S/C24H39NO3/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22(6-2)23(26)25-28-24(27)21(3)4/h7-8,10-11,13-14,22H,3,5-6,9,12,15-20H2,1-2,4H3,(H,25,26) |
| InChIKey | CGLNYBNSFFWYMC-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.58 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|