C24H40O3 — CID 174621325
2-methylprop-2-enoyl (9Z,12Z)-2-ethyloctadeca-9,12-dienoate (PubChem CID 174621325) has the molecular formula C24H40O3 and a molecular weight of 376.58 g/mol. Its IUPAC name is 2-methylprop-2-enoyl (9Z,12Z)-2-ethyloctadeca-9,12-dienoate.
| Compound Name | 2-methylprop-2-enoyl (9Z,12Z)-2-ethyloctadeca-9,12-dienoate |
|---|---|
| PubChem CID | 174621325 |
| Molecular Formula | C24H40O3 |
| Molecular Weight | 376.58 g/mol |
| Exact Mass | 376.30 |
| IUPAC Name | 2-methylprop-2-enoyl (9Z,12Z)-2-ethyloctadeca-9,12-dienoate |
| SMILES | C=C(C)C(=O)OC(=O)C(CC)CCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C24H40O3/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22(6-2)24(26)27-23(25)21(3)4/h10-11,13-14,22H,3,5-9,12,15-20H2,1-2,4H3/b11-10-,14-13- |
| InChIKey | SFQIMFKSNBUGSG-XVTLYKPTSA-N |
| XLogP | 7.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.58 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|