About 2-ethyloctadec-9-enamide
2-ethyloctadec-9-enamide (PubChem CID 160810733) has the molecular formula C20H39NO
and a molecular weight of 309.54 g/mol. Its IUPAC name is 2-ethyloctadec-9-enamide.
Molecular Properties
| Compound Name | 2-ethyloctadec-9-enamide |
| PubChem CID | 160810733 |
| Molecular Formula | C20H39NO |
| Molecular Weight | 309.54 g/mol |
| Exact Mass | 309.30 |
| IUPAC Name | 2-ethyloctadec-9-enamide |
| SMILES | CCCCCCCCC=CCCCCCCC(CC)C(N)=O |
| InChI | InChI=1S/C20H39NO/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(4-2)20(21)22/h11-12,19H,3-10,13-18H2,1-2H3,(H2,21,22) |
| InChIKey | UGWBFUGQLDOKOG-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 309.54 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyloctadec-9-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyloctadec-9-enamide?
The IUPAC name of 2-ethyloctadec-9-enamide (CID 160810733) is 2-ethyloctadec-9-enamide.
What is the SMILES notation for 2-ethyloctadec-9-enamide?
The canonical SMILES for 2-ethyloctadec-9-enamide is CCCCCCCCC=CCCCCCCC(CC)C(N)=O.
What is the InChIKey of 2-ethyloctadec-9-enamide?
The InChIKey is UGWBFUGQLDOKOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H39NO/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(4-2)20(21)22/h11-12,19H,3-10,13-18H2,1-2H3,(H2,21,22).
What are the key properties of 2-ethyloctadec-9-enamide?
2-ethyloctadec-9-enamide has a molecular weight of 309.54 g/mol, XLogP of 6.15, 16 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyloctadec-9-enamide is sourced from PubChem (CID 160810733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).