About 2-ethylhexadecanamide;octadecanamide
2-ethylhexadecanamide;octadecanamide (PubChem CID 159948815) has the molecular formula C36H74N2O2
and a molecular weight of 567.00 g/mol. Its IUPAC name is 2-ethylhexadecanamide;octadecanamide.
Molecular Properties
| Compound Name | 2-ethylhexadecanamide;octadecanamide |
| PubChem CID | 159948815 |
| Molecular Formula | C36H74N2O2 |
| Molecular Weight | 567.00 g/mol |
| Exact Mass | 566.58 |
| IUPAC Name | 2-ethylhexadecanamide;octadecanamide |
| SMILES | CCCCCCCCCCCCCCC(CC)C(N)=O.CCCCCCCCCCCCCCCCCC(N)=O |
| InChI | InChI=1S/2C18H37NO/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17(4-2)18(19)20;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h17H,3-16H2,1-2H3,(H2,19,20);2-17H2,1H3,(H2,19,20) |
| InChIKey | OBVKXTFXXAZAEE-UHFFFAOYSA-N |
| XLogP | 11.32 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 567.00 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylhexadecanamide;octadecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexadecanamide;octadecanamide?
The IUPAC name of 2-ethylhexadecanamide;octadecanamide (CID 159948815) is 2-ethylhexadecanamide;octadecanamide.
What is the SMILES notation for 2-ethylhexadecanamide;octadecanamide?
The canonical SMILES for 2-ethylhexadecanamide;octadecanamide is CCCCCCCCCCCCCCC(CC)C(N)=O.CCCCCCCCCCCCCCCCCC(N)=O.
What is the InChIKey of 2-ethylhexadecanamide;octadecanamide?
The InChIKey is OBVKXTFXXAZAEE-UHFFFAOYSA-N. The full InChI is InChI=1S/2C18H37NO/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17(4-2)18(19)20;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h17H,3-16H2,1-2H3,(H2,19,20);2-17H2,1H3,(H2,19,20).
What are the key properties of 2-ethylhexadecanamide;octadecanamide?
2-ethylhexadecanamide;octadecanamide has a molecular weight of 567.00 g/mol, XLogP of 11.32, 31 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexadecanamide;octadecanamide is sourced from PubChem (CID 159948815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).