About ethylboronic acid;2-ethylnonanamide
ethylboronic acid;2-ethylnonanamide (PubChem CID 175360947) has the molecular formula C13H30BNO3
and a molecular weight of 259.20 g/mol. Its IUPAC name is ethylboronic acid;2-ethylnonanamide.
Molecular Properties
| Compound Name | ethylboronic acid;2-ethylnonanamide |
| PubChem CID | 175360947 |
| Molecular Formula | C13H30BNO3 |
| Molecular Weight | 259.20 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | ethylboronic acid;2-ethylnonanamide |
| SMILES | CCB(O)O.CCCCCCCC(CC)C(N)=O |
| InChI | InChI=1S/C11H23NO.C2H7BO2/c1-3-5-6-7-8-9-10(4-2)11(12)13;1-2-3(4)5/h10H,3-9H2,1-2H3,(H2,12,13);4-5H,2H2,1H3 |
| InChIKey | FFNVPZOKHNRTEH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.20 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethylboronic acid;2-ethylnonanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylboronic acid;2-ethylnonanamide?
The IUPAC name of ethylboronic acid;2-ethylnonanamide (CID 175360947) is ethylboronic acid;2-ethylnonanamide.
What is the SMILES notation for ethylboronic acid;2-ethylnonanamide?
The canonical SMILES for ethylboronic acid;2-ethylnonanamide is CCB(O)O.CCCCCCCC(CC)C(N)=O.
What is the InChIKey of ethylboronic acid;2-ethylnonanamide?
The InChIKey is FFNVPZOKHNRTEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO.C2H7BO2/c1-3-5-6-7-8-9-10(4-2)11(12)13;1-2-3(4)5/h10H,3-9H2,1-2H3,(H2,12,13);4-5H,2H2,1H3.
What are the key properties of ethylboronic acid;2-ethylnonanamide?
ethylboronic acid;2-ethylnonanamide has a molecular weight of 259.20 g/mol, XLogP of 2.34, 9 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethylboronic acid;2-ethylnonanamide is sourced from PubChem (CID 175360947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).