C16H29O6P — CID 174371042
2-(2-methylprop-2-enoyloxycarbonyl)undecylphosphonic acid (PubChem CID 174371042) has the molecular formula C16H29O6P and a molecular weight of 348.38 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoyloxycarbonyl)undecylphosphonic acid.
| Compound Name | 2-(2-methylprop-2-enoyloxycarbonyl)undecylphosphonic acid |
|---|---|
| PubChem CID | 174371042 |
| Molecular Formula | C16H29O6P |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 2-(2-methylprop-2-enoyloxycarbonyl)undecylphosphonic acid |
| SMILES | C=C(C)C(=O)OC(=O)C(CCCCCCCCC)CP(=O)(O)O |
| InChI | InChI=1S/C16H29O6P/c1-4-5-6-7-8-9-10-11-14(12-23(19,20)21)16(18)22-15(17)13(2)3/h14H,2,4-12H2,1,3H3,(H2,19,20,21) |
| InChIKey | DDJVLEPCVLISIM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|