C16H29O7P — CID 87528739
11-(2-methylprop-2-enoyloxy)-2-(phosphonomethyl)undecanoic acid (PubChem CID 87528739) has the molecular formula C16H29O7P and a molecular weight of 364.38 g/mol. Its IUPAC name is 11-(2-methylprop-2-enoyloxy)-2-(phosphonomethyl)undecanoic acid.
| Compound Name | 11-(2-methylprop-2-enoyloxy)-2-(phosphonomethyl)undecanoic acid |
|---|---|
| PubChem CID | 87528739 |
| Molecular Formula | C16H29O7P |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 11-(2-methylprop-2-enoyloxy)-2-(phosphonomethyl)undecanoic acid |
| SMILES | C=C(C)C(=O)OCCCCCCCCCC(CP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C16H29O7P/c1-13(2)16(19)23-11-9-7-5-3-4-6-8-10-14(15(17)18)12-24(20,21)22/h14H,1,3-12H2,2H3,(H,17,18)(H2,20,21,22) |
| InChIKey | ODXWUIONXXTFJK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|