C24H34N4O8 — CID 42558482
(2R)-1-[6-[[(2R)-2-hydroxy-3-(4-nitrophenoxy)propyl]amino]hexylamino]-3-(4-nitrophenoxy)propan-2-ol (PubChem CID 42558482) has the molecular formula C24H34N4O8 and a molecular weight of 506.56 g/mol. Its IUPAC name is (2R)-1-[6-[[(2R)-2-hydroxy-3-(4-nitrophenoxy)propyl]amino]hexylamino]-3-(4-nitrophenoxy)propan-2-ol.
| Compound Name | (2R)-1-[6-[[(2R)-2-hydroxy-3-(4-nitrophenoxy)propyl]amino]hexylamino]-3-(4-nitrophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 42558482 |
| Molecular Formula | C24H34N4O8 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | (2R)-1-[6-[[(2R)-2-hydroxy-3-(4-nitrophenoxy)propyl]amino]hexylamino]-3-(4-nitrophenoxy)propan-2-ol |
| SMILES | O=[N+]([O-])c1ccc(OC[C@H](O)CNCCCCCCNC[C@@H](O)COc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C24H34N4O8/c29-21(17-35-23-9-5-19(6-10-23)27(31)32)15-25-13-3-1-2-4-14-26-16-22(30)18-36-24-11-7-20(8-12-24)28(33)34/h5-12,21-22,25-26,29-30H,1-4,13-18H2/t21-,22-/m1/s1 |
| InChIKey | AEVFLAOTVOCDSK-FGZHOGPDSA-N |
| XLogP | 2.42 |
| TPSA | 169.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|