C16H16F2N2O4 — CID 111104821
1-(3,4-difluorophenoxy)-3-[(4-nitrophenyl)methylamino]propan-2-ol (PubChem CID 111104821) has the molecular formula C16H16F2N2O4 and a molecular weight of 338.31 g/mol. Its IUPAC name is 1-(3,4-difluorophenoxy)-3-[(4-nitrophenyl)methylamino]propan-2-ol.
| Compound Name | 1-(3,4-difluorophenoxy)-3-[(4-nitrophenyl)methylamino]propan-2-ol |
|---|---|
| PubChem CID | 111104821 |
| Molecular Formula | C16H16F2N2O4 |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 1-(3,4-difluorophenoxy)-3-[(4-nitrophenyl)methylamino]propan-2-ol |
| SMILES | O=[N+]([O-])c1ccc(CNCC(O)COc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C16H16F2N2O4/c17-15-6-5-14(7-16(15)18)24-10-13(21)9-19-8-11-1-3-12(4-2-11)20(22)23/h1-7,13,19,21H,8-10H2 |
| InChIKey | NJXBFUFHWWJSIO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|