C19H25ClN2O6 — CID 3030980
1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-(4-nitrophenoxy)propan-2-ol;hydrochloride (PubChem CID 3030980) has the molecular formula C19H25ClN2O6 and a molecular weight of 412.87 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-(4-nitrophenoxy)propan-2-ol;hydrochloride.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-(4-nitrophenoxy)propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 3030980 |
| Molecular Formula | C19H25ClN2O6 |
| Molecular Weight | 412.87 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-(4-nitrophenoxy)propan-2-ol;hydrochloride |
| SMILES | COc1ccc(CCNCC(O)COc2ccc([N+](=O)[O-])cc2)cc1OC.Cl |
| InChI | InChI=1S/C19H24N2O6.ClH/c1-25-18-8-3-14(11-19(18)26-2)9-10-20-12-16(22)13-27-17-6-4-15(5-7-17)21(23)24;/h3-8,11,16,20,22H,9-10,12-13H2,1-2H3;1H |
| InChIKey | ITLHBZOLRQGNAN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.87 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|