C26H34N2O6 — CID 14011555
5-[2-(cyclopropylmethoxy)ethoxy]-2-[3-[2-(3,4-dimethoxyphenyl)ethylamino]-2-hydroxypropoxy]benzonitrile (PubChem CID 14011555) has the molecular formula C26H34N2O6 and a molecular weight of 470.57 g/mol. Its IUPAC name is 5-[2-(cyclopropylmethoxy)ethoxy]-2-[3-[2-(3,4-dimethoxyphenyl)ethylamino]-2-hydroxypropoxy]benzonitrile.
| Compound Name | 5-[2-(cyclopropylmethoxy)ethoxy]-2-[3-[2-(3,4-dimethoxyphenyl)ethylamino]-2-hydroxypropoxy]benzonitrile |
|---|---|
| PubChem CID | 14011555 |
| Molecular Formula | C26H34N2O6 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | 5-[2-(cyclopropylmethoxy)ethoxy]-2-[3-[2-(3,4-dimethoxyphenyl)ethylamino]-2-hydroxypropoxy]benzonitrile |
| SMILES | COc1ccc(CCNCC(O)COc2ccc(OCCOCC3CC3)cc2C#N)cc1OC |
| InChI | InChI=1S/C26H34N2O6/c1-30-25-7-5-19(13-26(25)31-2)9-10-28-16-22(29)18-34-24-8-6-23(14-21(24)15-27)33-12-11-32-17-20-3-4-20/h5-8,13-14,20,22,28-29H,3-4,9-12,16-18H2,1-2H3 |
| InChIKey | BQYKTWZVHBLFOO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|