C23H35N3O6 — CID 88626344
N-[2-[[3-[2-cyano-4-(2-propoxyethoxy)phenoxy]-2-hydroxypropyl]amino]ethyl]-N-(oxan-4-yl)formamide (PubChem CID 88626344) has the molecular formula C23H35N3O6 and a molecular weight of 449.55 g/mol. Its IUPAC name is N-[2-[[3-[2-cyano-4-(2-propoxyethoxy)phenoxy]-2-hydroxypropyl]amino]ethyl]-N-(oxan-4-yl)formamide.
| Compound Name | N-[2-[[3-[2-cyano-4-(2-propoxyethoxy)phenoxy]-2-hydroxypropyl]amino]ethyl]-N-(oxan-4-yl)formamide |
|---|---|
| PubChem CID | 88626344 |
| Molecular Formula | C23H35N3O6 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | N-[2-[[3-[2-cyano-4-(2-propoxyethoxy)phenoxy]-2-hydroxypropyl]amino]ethyl]-N-(oxan-4-yl)formamide |
| SMILES | CCCOCCOc1ccc(OCC(O)CNCCN(C=O)C2CCOCC2)c(C#N)c1 |
| InChI | InChI=1S/C23H35N3O6/c1-2-9-29-12-13-31-22-3-4-23(19(14-22)15-24)32-17-21(28)16-25-7-8-26(18-27)20-5-10-30-11-6-20/h3-4,14,18,20-21,25,28H,2,5-13,16-17H2,1H3 |
| InChIKey | WJYZBQGWTHZTHD-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 113.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|