C22H33NO8 — CID 44723712
but-2-enedioic acid;1-[4-[2-hydroxy-3-(propylamino)propoxy]-3-(propoxymethyl)phenyl]ethanone (PubChem CID 44723712) has the molecular formula C22H33NO8 and a molecular weight of 439.51 g/mol. Its IUPAC name is but-2-enedioic acid;1-[4-[2-hydroxy-3-(propylamino)propoxy]-3-(propoxymethyl)phenyl]ethanone.
| Compound Name | but-2-enedioic acid;1-[4-[2-hydroxy-3-(propylamino)propoxy]-3-(propoxymethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 44723712 |
| Molecular Formula | C22H33NO8 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | but-2-enedioic acid;1-[4-[2-hydroxy-3-(propylamino)propoxy]-3-(propoxymethyl)phenyl]ethanone |
| SMILES | CCCNCC(O)COc1ccc(C(C)=O)cc1COCCC.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C18H29NO4.C4H4O4/c1-4-8-19-11-17(21)13-23-18-7-6-15(14(3)20)10-16(18)12-22-9-5-2;5-3(6)1-2-4(7)8/h6-7,10,17,19,21H,4-5,8-9,11-13H2,1-3H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | RRTQOWYJPTYZBH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 142.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|