C28H31NO4 — CID 16638046
(E)-1-[2-[2-hydroxy-3-(propylamino)propoxy]-5-phenylmethoxyphenyl]-3-phenylprop-2-en-1-one (PubChem CID 16638046) has the molecular formula C28H31NO4 and a molecular weight of 445.56 g/mol. Its IUPAC name is (E)-1-[2-[2-hydroxy-3-(propylamino)propoxy]-5-phenylmethoxyphenyl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[2-[2-hydroxy-3-(propylamino)propoxy]-5-phenylmethoxyphenyl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 16638046 |
| Molecular Formula | C28H31NO4 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | (E)-1-[2-[2-hydroxy-3-(propylamino)propoxy]-5-phenylmethoxyphenyl]-3-phenylprop-2-en-1-one |
| SMILES | CCCNCC(O)COc1ccc(OCc2ccccc2)cc1C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C28H31NO4/c1-2-17-29-19-24(30)21-33-28-16-14-25(32-20-23-11-7-4-8-12-23)18-26(28)27(31)15-13-22-9-5-3-6-10-22/h3-16,18,24,29-30H,2,17,19-21H2,1H3/b15-13+ |
| InChIKey | STVHHBANCGMGSK-FYWRMAATSA-N |
| XLogP | 4.90 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|