3-[2,5-bis(phenylmethoxy)phenyl]-3-oxopropanoic acid

C23H20O5 — CID 170887038

IUPAC3-[2,5-bis(phenylmethoxy)phenyl]-3-oxopropanoic acid
SMILESO=C(O)CC(=O)c1cc(OCc2ccccc2)ccc1OCc1ccccc1
InChIInChI=1S/C23H20O5/c24-21(14-23(25)26)20-13-19(27-15-17-7-3-1-4-8-17)11-12-22(20)28-16-18-9-5-2-6-10-18/h1-13H,14-16H2,(H,25,26)
InChIKeyXGHPHGUYOWYUAY-UHFFFAOYSA-N
MW376.41 g/mol
LogP4.50
Rot. Bonds9

About 3-[2,5-bis(phenylmethoxy)phenyl]-3-oxopropanoic acid

3-[2,5-bis(phenylmethoxy)phenyl]-3-oxopropanoic acid (PubChem CID 170887038) has the molecular formula C23H20O5 and a molecular weight of 376.41 g/mol. Its IUPAC name is 3-[2,5-bis(phenylmethoxy)phenyl]-3-oxopropanoic acid.

Molecular Properties

Compound Name3-[2,5-bis(phenylmethoxy)phenyl]-3-oxopropanoic acid
PubChem CID170887038
Molecular FormulaC23H20O5
Molecular Weight376.41 g/mol
Exact Mass376.13
IUPAC Name3-[2,5-bis(phenylmethoxy)phenyl]-3-oxopropanoic acid
SMILESO=C(O)CC(=O)c1cc(OCc2ccccc2)ccc1OCc1ccccc1
InChIInChI=1S/C23H20O5/c24-21(14-23(25)26)20-13-19(27-15-17-7-3-1-4-8-17)11-12-22(20)28-16-18-9-5-2-6-10-18/h1-13H,14-16H2,(H,25,26)
InChIKeyXGHPHGUYOWYUAY-UHFFFAOYSA-N
XLogP4.50
TPSA72.83 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds9
Heavy Atoms28
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500376.41
LogP ≤ 54.50
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 3-[2,5-bis(phenylmethoxy)phenyl]-3-oxopropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2,5-bis(phenylmethoxy)phenyl]-3-oxopropanoic acid?
The IUPAC name of 3-[2,5-bis(phenylmethoxy)phenyl]-3-oxopropanoic acid (CID 170887038) is 3-[2,5-bis(phenylmethoxy)phenyl]-3-oxopropanoic acid.
What is the SMILES notation for 3-[2,5-bis(phenylmethoxy)phenyl]-3-oxopropanoic acid?
The canonical SMILES for 3-[2,5-bis(phenylmethoxy)phenyl]-3-oxopropanoic acid is O=C(O)CC(=O)c1cc(OCc2ccccc2)ccc1OCc1ccccc1.
What is the InChIKey of 3-[2,5-bis(phenylmethoxy)phenyl]-3-oxopropanoic acid?
The InChIKey is XGHPHGUYOWYUAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20O5/c24-21(14-23(25)26)20-13-19(27-15-17-7-3-1-4-8-17)11-12-22(20)28-16-18-9-5-2-6-10-18/h1-13H,14-16H2,(H,25,26).
What are the key properties of 3-[2,5-bis(phenylmethoxy)phenyl]-3-oxopropanoic acid?
3-[2,5-bis(phenylmethoxy)phenyl]-3-oxopropanoic acid has a molecular weight of 376.41 g/mol, XLogP of 4.50, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,5-bis(phenylmethoxy)phenyl]-3-oxopropanoic acid is sourced from PubChem (CID 170887038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).