C26H28N2O4 — CID 67653350
N-[4-(methylamino)-4-oxobutyl]-2,5-bis(phenylmethoxy)benzamide (PubChem CID 67653350) has the molecular formula C26H28N2O4 and a molecular weight of 432.52 g/mol. Its IUPAC name is N-[4-(methylamino)-4-oxobutyl]-2,5-bis(phenylmethoxy)benzamide.
| Compound Name | N-[4-(methylamino)-4-oxobutyl]-2,5-bis(phenylmethoxy)benzamide |
|---|---|
| PubChem CID | 67653350 |
| Molecular Formula | C26H28N2O4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | N-[4-(methylamino)-4-oxobutyl]-2,5-bis(phenylmethoxy)benzamide |
| SMILES | CNC(=O)CCCNC(=O)c1cc(OCc2ccccc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C26H28N2O4/c1-27-25(29)13-8-16-28-26(30)23-17-22(31-18-20-9-4-2-5-10-20)14-15-24(23)32-19-21-11-6-3-7-12-21/h2-7,9-12,14-15,17H,8,13,16,18-19H2,1H3,(H,27,29)(H,28,30) |
| InChIKey | YIEOUOFABNXCGM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|