C31H34N2O5 — CID 67833101
N-[6-oxo-6-(5-oxopyrrolidin-2-yl)hexyl]-2,5-bis(phenylmethoxy)benzamide (PubChem CID 67833101) has the molecular formula C31H34N2O5 and a molecular weight of 514.62 g/mol. Its IUPAC name is N-[6-oxo-6-(5-oxopyrrolidin-2-yl)hexyl]-2,5-bis(phenylmethoxy)benzamide.
| Compound Name | N-[6-oxo-6-(5-oxopyrrolidin-2-yl)hexyl]-2,5-bis(phenylmethoxy)benzamide |
|---|---|
| PubChem CID | 67833101 |
| Molecular Formula | C31H34N2O5 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | N-[6-oxo-6-(5-oxopyrrolidin-2-yl)hexyl]-2,5-bis(phenylmethoxy)benzamide |
| SMILES | O=C1CCC(C(=O)CCCCCNC(=O)c2cc(OCc3ccccc3)ccc2OCc2ccccc2)N1 |
| InChI | InChI=1S/C31H34N2O5/c34-28(27-16-18-30(35)33-27)14-8-3-9-19-32-31(36)26-20-25(37-21-23-10-4-1-5-11-23)15-17-29(26)38-22-24-12-6-2-7-13-24/h1-2,4-7,10-13,15,17,20,27H,3,8-9,14,16,18-19,21-22H2,(H,32,36)(H,33,35) |
| InChIKey | UPCBHVJMMLJGOF-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|