C26H26O4 — CID 54056047
ethyl 3-[2,5-bis(phenylmethoxy)phenyl]but-2-enoate (PubChem CID 54056047) has the molecular formula C26H26O4 and a molecular weight of 402.49 g/mol. Its IUPAC name is ethyl 3-[2,5-bis(phenylmethoxy)phenyl]but-2-enoate.
| Compound Name | ethyl 3-[2,5-bis(phenylmethoxy)phenyl]but-2-enoate |
|---|---|
| PubChem CID | 54056047 |
| Molecular Formula | C26H26O4 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | ethyl 3-[2,5-bis(phenylmethoxy)phenyl]but-2-enoate |
| SMILES | CCOC(=O)C=C(C)c1cc(OCc2ccccc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C26H26O4/c1-3-28-26(27)16-20(2)24-17-23(29-18-21-10-6-4-7-11-21)14-15-25(24)30-19-22-12-8-5-9-13-22/h4-17H,3,18-19H2,1-2H3 |
| InChIKey | LWIBPOCIMSZVBX-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|