C23H23NO4S — CID 123669003
ethyl 3-(2-methoxy-5-phenylmethoxyphenyl)-3-(5-methyl-1,3-thiazol-2-yl)prop-2-enoate (PubChem CID 123669003) has the molecular formula C23H23NO4S and a molecular weight of 409.51 g/mol. Its IUPAC name is ethyl 3-(2-methoxy-5-phenylmethoxyphenyl)-3-(5-methyl-1,3-thiazol-2-yl)prop-2-enoate.
| Compound Name | ethyl 3-(2-methoxy-5-phenylmethoxyphenyl)-3-(5-methyl-1,3-thiazol-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 123669003 |
| Molecular Formula | C23H23NO4S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | ethyl 3-(2-methoxy-5-phenylmethoxyphenyl)-3-(5-methyl-1,3-thiazol-2-yl)prop-2-enoate |
| SMILES | CCOC(=O)C=C(c1ncc(C)s1)c1cc(OCc2ccccc2)ccc1OC |
| InChI | InChI=1S/C23H23NO4S/c1-4-27-22(25)13-20(23-24-14-16(2)29-23)19-12-18(10-11-21(19)26-3)28-15-17-8-6-5-7-9-17/h5-14H,4,15H2,1-3H3 |
| InChIKey | SCIPWPURVGANRA-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|