C15H13BrClNO2S — CID 123371652
ethyl 3-(3-bromo-5-chlorophenyl)-3-(5-methyl-1,3-thiazol-2-yl)prop-2-enoate (PubChem CID 123371652) has the molecular formula C15H13BrClNO2S and a molecular weight of 386.70 g/mol. Its IUPAC name is ethyl 3-(3-bromo-5-chlorophenyl)-3-(5-methyl-1,3-thiazol-2-yl)prop-2-enoate.
| Compound Name | ethyl 3-(3-bromo-5-chlorophenyl)-3-(5-methyl-1,3-thiazol-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 123371652 |
| Molecular Formula | C15H13BrClNO2S |
| Molecular Weight | 386.70 g/mol |
| Exact Mass | 384.95 |
| IUPAC Name | ethyl 3-(3-bromo-5-chlorophenyl)-3-(5-methyl-1,3-thiazol-2-yl)prop-2-enoate |
| SMILES | CCOC(=O)C=C(c1cc(Cl)cc(Br)c1)c1ncc(C)s1 |
| InChI | InChI=1S/C15H13BrClNO2S/c1-3-20-14(19)7-13(15-18-8-9(2)21-15)10-4-11(16)6-12(17)5-10/h4-8H,3H2,1-2H3 |
| InChIKey | WLIBLQNJVAVQIV-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.70 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|