C26H26O4 — CID 90811092
1-[5-ethyl-2,4-bis(phenylmethoxy)phenyl]butane-1,3-dione (PubChem CID 90811092) has the molecular formula C26H26O4 and a molecular weight of 402.49 g/mol. Its IUPAC name is 1-[5-ethyl-2,4-bis(phenylmethoxy)phenyl]butane-1,3-dione.
| Compound Name | 1-[5-ethyl-2,4-bis(phenylmethoxy)phenyl]butane-1,3-dione |
|---|---|
| PubChem CID | 90811092 |
| Molecular Formula | C26H26O4 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 1-[5-ethyl-2,4-bis(phenylmethoxy)phenyl]butane-1,3-dione |
| SMILES | CCc1cc(C(=O)CC(C)=O)c(OCc2ccccc2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C26H26O4/c1-3-22-15-23(24(28)14-19(2)27)26(30-18-21-12-8-5-9-13-21)16-25(22)29-17-20-10-6-4-7-11-20/h4-13,15-16H,3,14,17-18H2,1-2H3 |
| InChIKey | HEDGAYWXVQOBGV-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|