C27H21F2NO3 — CID 141216434
2,5-bis[(3-fluorophenyl)methoxy]-N-phenylbenzamide (PubChem CID 141216434) has the molecular formula C27H21F2NO3 and a molecular weight of 445.47 g/mol. Its IUPAC name is 2,5-bis[(3-fluorophenyl)methoxy]-N-phenylbenzamide.
| Compound Name | 2,5-bis[(3-fluorophenyl)methoxy]-N-phenylbenzamide |
|---|---|
| PubChem CID | 141216434 |
| Molecular Formula | C27H21F2NO3 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 2,5-bis[(3-fluorophenyl)methoxy]-N-phenylbenzamide |
| SMILES | O=C(Nc1ccccc1)c1cc(OCc2cccc(F)c2)ccc1OCc1cccc(F)c1 |
| InChI | InChI=1S/C27H21F2NO3/c28-21-8-4-6-19(14-21)17-32-24-12-13-26(33-18-20-7-5-9-22(29)15-20)25(16-24)27(31)30-23-10-2-1-3-11-23/h1-16H,17-18H2,(H,30,31) |
| InChIKey | QNJXMYZGPZSDFL-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |