C23H21ClFNO5 — CID 72704750
N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-2-hydroxy-4-(2-methoxyethoxy)benzamide (PubChem CID 72704750) has the molecular formula C23H21ClFNO5 and a molecular weight of 445.87 g/mol. Its IUPAC name is N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-2-hydroxy-4-(2-methoxyethoxy)benzamide.
| Compound Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-2-hydroxy-4-(2-methoxyethoxy)benzamide |
|---|---|
| PubChem CID | 72704750 |
| Molecular Formula | C23H21ClFNO5 |
| Molecular Weight | 445.87 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-2-hydroxy-4-(2-methoxyethoxy)benzamide |
| SMILES | COCCOc1ccc(C(=O)Nc2ccc(OCc3cccc(F)c3)c(Cl)c2)c(O)c1 |
| InChI | InChI=1S/C23H21ClFNO5/c1-29-9-10-30-18-6-7-19(21(27)13-18)23(28)26-17-5-8-22(20(24)12-17)31-14-15-3-2-4-16(25)11-15/h2-8,11-13,27H,9-10,14H2,1H3,(H,26,28) |
| InChIKey | WNYXWMKWNAMSFY-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.87 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|