C22H18ClFN2O4 — CID 33065215
3-(2-amino-2-oxoethoxy)-N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]benzamide (PubChem CID 33065215) has the molecular formula C22H18ClFN2O4 and a molecular weight of 428.85 g/mol. Its IUPAC name is 3-(2-amino-2-oxoethoxy)-N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]benzamide.
| Compound Name | 3-(2-amino-2-oxoethoxy)-N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]benzamide |
|---|---|
| PubChem CID | 33065215 |
| Molecular Formula | C22H18ClFN2O4 |
| Molecular Weight | 428.85 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 3-(2-amino-2-oxoethoxy)-N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]benzamide |
| SMILES | NC(=O)COc1cccc(C(=O)Nc2ccc(OCc3cccc(F)c3)c(Cl)c2)c1 |
| InChI | InChI=1S/C22H18ClFN2O4/c23-19-11-17(7-8-20(19)30-12-14-3-1-5-16(24)9-14)26-22(28)15-4-2-6-18(10-15)29-13-21(25)27/h1-11H,12-13H2,(H2,25,27)(H,26,28) |
| InChIKey | CIXREDDZWOSDON-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.85 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |