C23H20FN3O4 — CID 55947735
3-[2-[[3-[(3-fluorobenzoyl)amino]phenyl]methylamino]-2-oxoethoxy]benzamide (PubChem CID 55947735) has the molecular formula C23H20FN3O4 and a molecular weight of 421.43 g/mol. Its IUPAC name is 3-[2-[[3-[(3-fluorobenzoyl)amino]phenyl]methylamino]-2-oxoethoxy]benzamide.
| Compound Name | 3-[2-[[3-[(3-fluorobenzoyl)amino]phenyl]methylamino]-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 55947735 |
| Molecular Formula | C23H20FN3O4 |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 3-[2-[[3-[(3-fluorobenzoyl)amino]phenyl]methylamino]-2-oxoethoxy]benzamide |
| SMILES | NC(=O)c1cccc(OCC(=O)NCc2cccc(NC(=O)c3cccc(F)c3)c2)c1 |
| InChI | InChI=1S/C23H20FN3O4/c24-18-7-2-6-17(11-18)23(30)27-19-8-1-4-15(10-19)13-26-21(28)14-31-20-9-3-5-16(12-20)22(25)29/h1-12H,13-14H2,(H2,25,29)(H,26,28)(H,27,30) |
| InChIKey | NQHALSRXFVRAMW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |