C18H16FN3O2S — CID 47063751
N-[3-[[[2-(cyanomethylsulfanyl)acetyl]amino]methyl]phenyl]-3-fluorobenzamide (PubChem CID 47063751) has the molecular formula C18H16FN3O2S and a molecular weight of 357.41 g/mol. Its IUPAC name is N-[3-[[[2-(cyanomethylsulfanyl)acetyl]amino]methyl]phenyl]-3-fluorobenzamide.
| Compound Name | N-[3-[[[2-(cyanomethylsulfanyl)acetyl]amino]methyl]phenyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 47063751 |
| Molecular Formula | C18H16FN3O2S |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | N-[3-[[[2-(cyanomethylsulfanyl)acetyl]amino]methyl]phenyl]-3-fluorobenzamide |
| SMILES | N#CCSCC(=O)NCc1cccc(NC(=O)c2cccc(F)c2)c1 |
| InChI | InChI=1S/C18H16FN3O2S/c19-15-5-2-4-14(10-15)18(24)22-16-6-1-3-13(9-16)11-21-17(23)12-25-8-7-20/h1-6,9-10H,8,11-12H2,(H,21,23)(H,22,24) |
| InChIKey | PFUDVUOEHRFYFV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|