C23H18F2N2O2 — CID 55894437
3-fluoro-N-[3-[[3-(3-fluorophenyl)prop-2-enoylamino]methyl]phenyl]benzamide (PubChem CID 55894437) has the molecular formula C23H18F2N2O2 and a molecular weight of 392.41 g/mol. Its IUPAC name is 3-fluoro-N-[3-[[3-(3-fluorophenyl)prop-2-enoylamino]methyl]phenyl]benzamide.
| Compound Name | 3-fluoro-N-[3-[[3-(3-fluorophenyl)prop-2-enoylamino]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 55894437 |
| Molecular Formula | C23H18F2N2O2 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 3-fluoro-N-[3-[[3-(3-fluorophenyl)prop-2-enoylamino]methyl]phenyl]benzamide |
| SMILES | O=C(C=Cc1cccc(F)c1)NCc1cccc(NC(=O)c2cccc(F)c2)c1 |
| InChI | InChI=1S/C23H18F2N2O2/c24-19-7-1-4-16(12-19)10-11-22(28)26-15-17-5-2-9-21(13-17)27-23(29)18-6-3-8-20(25)14-18/h1-14H,15H2,(H,26,28)(H,27,29) |
| InChIKey | DUXNIGLLVMVOGS-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|