C25H23FN2O4 — CID 55893037
N-[3-[[[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]amino]methyl]phenyl]-3-fluorobenzamide (PubChem CID 55893037) has the molecular formula C25H23FN2O4 and a molecular weight of 434.47 g/mol. Its IUPAC name is N-[3-[[[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]amino]methyl]phenyl]-3-fluorobenzamide.
| Compound Name | N-[3-[[[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]amino]methyl]phenyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 55893037 |
| Molecular Formula | C25H23FN2O4 |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | N-[3-[[[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]amino]methyl]phenyl]-3-fluorobenzamide |
| SMILES | COc1ccc(/C=C/C(=O)NCc2cccc(NC(=O)c3cccc(F)c3)c2)c(OC)c1 |
| InChI | InChI=1S/C25H23FN2O4/c1-31-22-11-9-18(23(15-22)32-2)10-12-24(29)27-16-17-5-3-8-21(13-17)28-25(30)19-6-4-7-20(26)14-19/h3-15H,16H2,1-2H3,(H,27,29)(H,28,30)/b12-10+ |
| InChIKey | FUWISZDBJWTCEC-ZRDIBKRKSA-N |
| XLogP | 4.42 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|