C17H14FNO3 — CID 84761715
3-[[[(E)-3-(3-fluorophenyl)prop-2-enoyl]amino]methyl]benzoic acid (PubChem CID 84761715) has the molecular formula C17H14FNO3 and a molecular weight of 299.30 g/mol. Its IUPAC name is 3-[[[(E)-3-(3-fluorophenyl)prop-2-enoyl]amino]methyl]benzoic acid.
| Compound Name | 3-[[[(E)-3-(3-fluorophenyl)prop-2-enoyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 84761715 |
| Molecular Formula | C17H14FNO3 |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 3-[[[(E)-3-(3-fluorophenyl)prop-2-enoyl]amino]methyl]benzoic acid |
| SMILES | O=C(/C=C/c1cccc(F)c1)NCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C17H14FNO3/c18-15-6-2-3-12(10-15)7-8-16(20)19-11-13-4-1-5-14(9-13)17(21)22/h1-10H,11H2,(H,19,20)(H,21,22)/b8-7+ |
| InChIKey | XLIJUSZPYIUMLE-BQYQJAHWSA-N |
| XLogP | 2.85 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|