C18H18FNO — CID 4810838
3-(3-fluorophenyl)-N-(3-phenylpropyl)prop-2-enamide (PubChem CID 4810838) has the molecular formula C18H18FNO and a molecular weight of 283.35 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-N-(3-phenylpropyl)prop-2-enamide.
| Compound Name | 3-(3-fluorophenyl)-N-(3-phenylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 4810838 |
| Molecular Formula | C18H18FNO |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 3-(3-fluorophenyl)-N-(3-phenylpropyl)prop-2-enamide |
| SMILES | O=C(C=Cc1cccc(F)c1)NCCCc1ccccc1 |
| InChI | InChI=1S/C18H18FNO/c19-17-10-4-8-16(14-17)11-12-18(21)20-13-5-9-15-6-2-1-3-7-15/h1-4,6-8,10-12,14H,5,9,13H2,(H,20,21) |
| InChIKey | AGYLAMOLHXCSFU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|