C17H17FN2O — CID 39384361
(E)-3-(3-amino-4-fluorophenyl)-N-(2-phenylethyl)prop-2-enamide (PubChem CID 39384361) has the molecular formula C17H17FN2O and a molecular weight of 284.33 g/mol. Its IUPAC name is (E)-3-(3-amino-4-fluorophenyl)-N-(2-phenylethyl)prop-2-enamide.
| Compound Name | (E)-3-(3-amino-4-fluorophenyl)-N-(2-phenylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 39384361 |
| Molecular Formula | C17H17FN2O |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | (E)-3-(3-amino-4-fluorophenyl)-N-(2-phenylethyl)prop-2-enamide |
| SMILES | Nc1cc(/C=C/C(=O)NCCc2ccccc2)ccc1F |
| InChI | InChI=1S/C17H17FN2O/c18-15-8-6-14(12-16(15)19)7-9-17(21)20-11-10-13-4-2-1-3-5-13/h1-9,12H,10-11,19H2,(H,20,21)/b9-7+ |
| InChIKey | LLUUPMKMNJTECH-VQHVLOKHSA-N |
| XLogP | 2.78 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|