C28H23NO5 — CID 10434059
(E)-3-[4-[2-oxo-2-[4-[(E)-3-oxo-3-(2-phenylethylamino)prop-1-enyl]phenyl]acetyl]phenyl]prop-2-enoic acid (PubChem CID 10434059) has the molecular formula C28H23NO5 and a molecular weight of 453.49 g/mol. Its IUPAC name is (E)-3-[4-[2-oxo-2-[4-[(E)-3-oxo-3-(2-phenylethylamino)prop-1-enyl]phenyl]acetyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[2-oxo-2-[4-[(E)-3-oxo-3-(2-phenylethylamino)prop-1-enyl]phenyl]acetyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 10434059 |
| Molecular Formula | C28H23NO5 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | (E)-3-[4-[2-oxo-2-[4-[(E)-3-oxo-3-(2-phenylethylamino)prop-1-enyl]phenyl]acetyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(C(=O)C(=O)c2ccc(/C=C/C(=O)NCCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C28H23NO5/c30-25(29-19-18-20-4-2-1-3-5-20)16-10-21-6-12-23(13-7-21)27(33)28(34)24-14-8-22(9-15-24)11-17-26(31)32/h1-17H,18-19H2,(H,29,30)(H,31,32)/b16-10+,17-11+ |
| InChIKey | SDYJNDVUVCHGEU-OTYYAQKOSA-N |
| XLogP | 4.22 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|