C21H24N2O2 — CID 110300693
N,N-dimethyl-4-[(E)-3-oxo-3-(3-phenylpropylamino)prop-1-enyl]benzamide (PubChem CID 110300693) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is N,N-dimethyl-4-[(E)-3-oxo-3-(3-phenylpropylamino)prop-1-enyl]benzamide.
| Compound Name | N,N-dimethyl-4-[(E)-3-oxo-3-(3-phenylpropylamino)prop-1-enyl]benzamide |
|---|---|
| PubChem CID | 110300693 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | N,N-dimethyl-4-[(E)-3-oxo-3-(3-phenylpropylamino)prop-1-enyl]benzamide |
| SMILES | CN(C)C(=O)c1ccc(/C=C/C(=O)NCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H24N2O2/c1-23(2)21(25)19-13-10-18(11-14-19)12-15-20(24)22-16-6-9-17-7-4-3-5-8-17/h3-5,7-8,10-15H,6,9,16H2,1-2H3,(H,22,24)/b15-12+ |
| InChIKey | ASIDFXNTNFFYLZ-NTCAYCPXSA-N |
| XLogP | 3.15 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|