C25H21FN4O3 — CID 154858606
1-[2-[[3-[(3-fluorobenzoyl)amino]phenyl]methylamino]-2-oxoethyl]indole-3-carboxamide (PubChem CID 154858606) has the molecular formula C25H21FN4O3 and a molecular weight of 444.47 g/mol. Its IUPAC name is 1-[2-[[3-[(3-fluorobenzoyl)amino]phenyl]methylamino]-2-oxoethyl]indole-3-carboxamide.
| Compound Name | 1-[2-[[3-[(3-fluorobenzoyl)amino]phenyl]methylamino]-2-oxoethyl]indole-3-carboxamide |
|---|---|
| PubChem CID | 154858606 |
| Molecular Formula | C25H21FN4O3 |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 1-[2-[[3-[(3-fluorobenzoyl)amino]phenyl]methylamino]-2-oxoethyl]indole-3-carboxamide |
| SMILES | NC(=O)c1cn(CC(=O)NCc2cccc(NC(=O)c3cccc(F)c3)c2)c2ccccc12 |
| InChI | InChI=1S/C25H21FN4O3/c26-18-7-4-6-17(12-18)25(33)29-19-8-3-5-16(11-19)13-28-23(31)15-30-14-21(24(27)32)20-9-1-2-10-22(20)30/h1-12,14H,13,15H2,(H2,27,32)(H,28,31)(H,29,33) |
| InChIKey | ACSXWOATWVIUJL-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 106.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |