C28H24BrNO3 — CID 141273565
5-(2-bromoethoxy)-2-phenylmethoxy-N-(3-phenylphenyl)benzamide (PubChem CID 141273565) has the molecular formula C28H24BrNO3 and a molecular weight of 502.41 g/mol. Its IUPAC name is 5-(2-bromoethoxy)-2-phenylmethoxy-N-(3-phenylphenyl)benzamide.
| Compound Name | 5-(2-bromoethoxy)-2-phenylmethoxy-N-(3-phenylphenyl)benzamide |
|---|---|
| PubChem CID | 141273565 |
| Molecular Formula | C28H24BrNO3 |
| Molecular Weight | 502.41 g/mol |
| Exact Mass | 501.09 |
| IUPAC Name | 5-(2-bromoethoxy)-2-phenylmethoxy-N-(3-phenylphenyl)benzamide |
| SMILES | O=C(Nc1cccc(-c2ccccc2)c1)c1cc(OCCBr)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C28H24BrNO3/c29-16-17-32-25-14-15-27(33-20-21-8-3-1-4-9-21)26(19-25)28(31)30-24-13-7-12-23(18-24)22-10-5-2-6-11-22/h1-15,18-19H,16-17,20H2,(H,30,31) |
| InChIKey | QATRDNSNQIFPDV-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.41 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|