C32H30BrNO5 — CID 142764678
tert-butyl 2-[[5-(bromomethoxy)-2-phenylmethoxybenzoyl]amino]-4-phenylbenzoate (PubChem CID 142764678) has the molecular formula C32H30BrNO5 and a molecular weight of 588.50 g/mol. Its IUPAC name is tert-butyl 2-[[5-(bromomethoxy)-2-phenylmethoxybenzoyl]amino]-4-phenylbenzoate.
| Compound Name | tert-butyl 2-[[5-(bromomethoxy)-2-phenylmethoxybenzoyl]amino]-4-phenylbenzoate |
|---|---|
| PubChem CID | 142764678 |
| Molecular Formula | C32H30BrNO5 |
| Molecular Weight | 588.50 g/mol |
| Exact Mass | 587.13 |
| IUPAC Name | tert-butyl 2-[[5-(bromomethoxy)-2-phenylmethoxybenzoyl]amino]-4-phenylbenzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(-c2ccccc2)cc1NC(=O)c1cc(OCBr)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C32H30BrNO5/c1-32(2,3)39-31(36)26-16-14-24(23-12-8-5-9-13-23)18-28(26)34-30(35)27-19-25(38-21-33)15-17-29(27)37-20-22-10-6-4-7-11-22/h4-19H,20-21H2,1-3H3,(H,34,35) |
| InChIKey | MCSFZZGHUGBTHW-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.50 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|