C32H39N3O5 — CID 66990856
tert-butyl 2-[[2-(methoxymethoxy)-5-[(4-methylpiperazin-1-yl)methyl]benzoyl]amino]-4-phenylbenzoate (PubChem CID 66990856) has the molecular formula C32H39N3O5 and a molecular weight of 545.68 g/mol. Its IUPAC name is tert-butyl 2-[[2-(methoxymethoxy)-5-[(4-methylpiperazin-1-yl)methyl]benzoyl]amino]-4-phenylbenzoate.
| Compound Name | tert-butyl 2-[[2-(methoxymethoxy)-5-[(4-methylpiperazin-1-yl)methyl]benzoyl]amino]-4-phenylbenzoate |
|---|---|
| PubChem CID | 66990856 |
| Molecular Formula | C32H39N3O5 |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.29 |
| IUPAC Name | tert-butyl 2-[[2-(methoxymethoxy)-5-[(4-methylpiperazin-1-yl)methyl]benzoyl]amino]-4-phenylbenzoate |
| SMILES | COCOc1ccc(CN2CCN(C)CC2)cc1C(=O)Nc1cc(-c2ccccc2)ccc1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H39N3O5/c1-32(2,3)40-31(37)26-13-12-25(24-9-7-6-8-10-24)20-28(26)33-30(36)27-19-23(11-14-29(27)39-22-38-5)21-35-17-15-34(4)16-18-35/h6-14,19-20H,15-18,21-22H2,1-5H3,(H,33,36) |
| InChIKey | BHDZFHOGHZOFIJ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|