C32H38N2O5 — CID 70668649
methyl 2-[[2-butoxy-5-[(1-methylpiperidin-4-yl)methoxy]benzoyl]amino]-4-phenylbenzoate (PubChem CID 70668649) has the molecular formula C32H38N2O5 and a molecular weight of 530.67 g/mol. Its IUPAC name is methyl 2-[[2-butoxy-5-[(1-methylpiperidin-4-yl)methoxy]benzoyl]amino]-4-phenylbenzoate.
| Compound Name | methyl 2-[[2-butoxy-5-[(1-methylpiperidin-4-yl)methoxy]benzoyl]amino]-4-phenylbenzoate |
|---|---|
| PubChem CID | 70668649 |
| Molecular Formula | C32H38N2O5 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.28 |
| IUPAC Name | methyl 2-[[2-butoxy-5-[(1-methylpiperidin-4-yl)methoxy]benzoyl]amino]-4-phenylbenzoate |
| SMILES | CCCCOc1ccc(OCC2CCN(C)CC2)cc1C(=O)Nc1cc(-c2ccccc2)ccc1C(=O)OC |
| InChI | InChI=1S/C32H38N2O5/c1-4-5-19-38-30-14-12-26(39-22-23-15-17-34(2)18-16-23)21-28(30)31(35)33-29-20-25(24-9-7-6-8-10-24)11-13-27(29)32(36)37-3/h6-14,20-21,23H,4-5,15-19,22H2,1-3H3,(H,33,35) |
| InChIKey | KHHVDOIGOXLBJL-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|