C30H35N3O10S2 — CID 87227391
2-[[2-methylsulfonyloxy-5-[2-[4-(2-methylsulfonyloxyethyl)piperazin-1-yl]ethoxy]benzoyl]amino]-4-phenylbenzoic acid (PubChem CID 87227391) has the molecular formula C30H35N3O10S2 and a molecular weight of 661.76 g/mol. Its IUPAC name is 2-[[2-methylsulfonyloxy-5-[2-[4-(2-methylsulfonyloxyethyl)piperazin-1-yl]ethoxy]benzoyl]amino]-4-phenylbenzoic acid.
| Compound Name | 2-[[2-methylsulfonyloxy-5-[2-[4-(2-methylsulfonyloxyethyl)piperazin-1-yl]ethoxy]benzoyl]amino]-4-phenylbenzoic acid |
|---|---|
| PubChem CID | 87227391 |
| Molecular Formula | C30H35N3O10S2 |
| Molecular Weight | 661.76 g/mol |
| Exact Mass | 661.18 |
| IUPAC Name | 2-[[2-methylsulfonyloxy-5-[2-[4-(2-methylsulfonyloxyethyl)piperazin-1-yl]ethoxy]benzoyl]amino]-4-phenylbenzoic acid |
| SMILES | CS(=O)(=O)OCCN1CCN(CCOc2ccc(OS(C)(=O)=O)c(C(=O)Nc3cc(-c4ccccc4)ccc3C(=O)O)c2)CC1 |
| InChI | InChI=1S/C30H35N3O10S2/c1-44(37,38)42-19-17-33-14-12-32(13-15-33)16-18-41-24-9-11-28(43-45(2,39)40)26(21-24)29(34)31-27-20-23(8-10-25(27)30(35)36)22-6-4-3-5-7-22/h3-11,20-21H,12-19H2,1-2H3,(H,31,34)(H,35,36) |
| InChIKey | HAKLKOBWISDKNR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 168.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.76 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|