C28H35N3O11S2 — CID 87227143
2-[[2-hydroxy-5-(2-piperazin-1-ylethoxy)benzoyl]amino]-4-phenylbenzoic acid;methanesulfonic acid (PubChem CID 87227143) has the molecular formula C28H35N3O11S2 and a molecular weight of 653.73 g/mol. Its IUPAC name is 2-[[2-hydroxy-5-(2-piperazin-1-ylethoxy)benzoyl]amino]-4-phenylbenzoic acid;methanesulfonic acid.
| Compound Name | 2-[[2-hydroxy-5-(2-piperazin-1-ylethoxy)benzoyl]amino]-4-phenylbenzoic acid;methanesulfonic acid |
|---|---|
| PubChem CID | 87227143 |
| Molecular Formula | C28H35N3O11S2 |
| Molecular Weight | 653.73 g/mol |
| Exact Mass | 653.17 |
| IUPAC Name | 2-[[2-hydroxy-5-(2-piperazin-1-ylethoxy)benzoyl]amino]-4-phenylbenzoic acid;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.CS(=O)(=O)O.O=C(Nc1cc(-c2ccccc2)ccc1C(=O)O)c1cc(OCCN2CCNCC2)ccc1O |
| InChI | InChI=1S/C26H27N3O5.2CH4O3S/c30-24-9-7-20(34-15-14-29-12-10-27-11-13-29)17-22(24)25(31)28-23-16-19(6-8-21(23)26(32)33)18-4-2-1-3-5-18;2*1-5(2,3)4/h1-9,16-17,27,30H,10-15H2,(H,28,31)(H,32,33);2*1H3,(H,2,3,4) |
| InChIKey | JIJFIRCJWJSXPH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 219.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.73 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|