C25H24N2O5 — CID 87227519
2-[[2-hydroxy-5-(morpholin-4-ylmethyl)benzoyl]amino]-4-phenylbenzoic acid (PubChem CID 87227519) has the molecular formula C25H24N2O5 and a molecular weight of 432.48 g/mol. Its IUPAC name is 2-[[2-hydroxy-5-(morpholin-4-ylmethyl)benzoyl]amino]-4-phenylbenzoic acid.
| Compound Name | 2-[[2-hydroxy-5-(morpholin-4-ylmethyl)benzoyl]amino]-4-phenylbenzoic acid |
|---|---|
| PubChem CID | 87227519 |
| Molecular Formula | C25H24N2O5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 2-[[2-hydroxy-5-(morpholin-4-ylmethyl)benzoyl]amino]-4-phenylbenzoic acid |
| SMILES | O=C(Nc1cc(-c2ccccc2)ccc1C(=O)O)c1cc(CN2CCOCC2)ccc1O |
| InChI | InChI=1S/C25H24N2O5/c28-23-9-6-17(16-27-10-12-32-13-11-27)14-21(23)24(29)26-22-15-19(7-8-20(22)25(30)31)18-4-2-1-3-5-18/h1-9,14-15,28H,10-13,16H2,(H,26,29)(H,30,31) |
| InChIKey | BLHDSGDBEQRGLV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |