C30H34N2O4 — CID 58508608
tert-butyl 2-[[5-(4-hydroxypiperidin-1-yl)-2-methylbenzoyl]amino]-4-phenylbenzoate (PubChem CID 58508608) has the molecular formula C30H34N2O4 and a molecular weight of 486.61 g/mol. Its IUPAC name is tert-butyl 2-[[5-(4-hydroxypiperidin-1-yl)-2-methylbenzoyl]amino]-4-phenylbenzoate.
| Compound Name | tert-butyl 2-[[5-(4-hydroxypiperidin-1-yl)-2-methylbenzoyl]amino]-4-phenylbenzoate |
|---|---|
| PubChem CID | 58508608 |
| Molecular Formula | C30H34N2O4 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | tert-butyl 2-[[5-(4-hydroxypiperidin-1-yl)-2-methylbenzoyl]amino]-4-phenylbenzoate |
| SMILES | Cc1ccc(N2CCC(O)CC2)cc1C(=O)Nc1cc(-c2ccccc2)ccc1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H34N2O4/c1-20-10-12-23(32-16-14-24(33)15-17-32)19-26(20)28(34)31-27-18-22(21-8-6-5-7-9-21)11-13-25(27)29(35)36-30(2,3)4/h5-13,18-19,24,33H,14-17H2,1-4H3,(H,31,34) |
| InChIKey | ITRIUAYETLUVNO-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |