C25H29BrN2O5 — CID 66990071
tert-butyl 2-[(2-acetyloxy-5-piperidin-1-ylbenzoyl)amino]-4-bromobenzoate (PubChem CID 66990071) has the molecular formula C25H29BrN2O5 and a molecular weight of 517.42 g/mol. Its IUPAC name is tert-butyl 2-[(2-acetyloxy-5-piperidin-1-ylbenzoyl)amino]-4-bromobenzoate.
| Compound Name | tert-butyl 2-[(2-acetyloxy-5-piperidin-1-ylbenzoyl)amino]-4-bromobenzoate |
|---|---|
| PubChem CID | 66990071 |
| Molecular Formula | C25H29BrN2O5 |
| Molecular Weight | 517.42 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | tert-butyl 2-[(2-acetyloxy-5-piperidin-1-ylbenzoyl)amino]-4-bromobenzoate |
| SMILES | CC(=O)Oc1ccc(N2CCCCC2)cc1C(=O)Nc1cc(Br)ccc1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H29BrN2O5/c1-16(29)32-22-11-9-18(28-12-6-5-7-13-28)15-20(22)23(30)27-21-14-17(26)8-10-19(21)24(31)33-25(2,3)4/h8-11,14-15H,5-7,12-13H2,1-4H3,(H,27,30) |
| InChIKey | JYPICZDLBGTPQH-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.42 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|