C17H26N4O2S — CID 169356250
tert-butyl 2-(carbamothioylamino)-4-(4-methylpiperazin-1-yl)benzoate (PubChem CID 169356250) has the molecular formula C17H26N4O2S and a molecular weight of 350.49 g/mol. Its IUPAC name is tert-butyl 2-(carbamothioylamino)-4-(4-methylpiperazin-1-yl)benzoate.
| Compound Name | tert-butyl 2-(carbamothioylamino)-4-(4-methylpiperazin-1-yl)benzoate |
|---|---|
| PubChem CID | 169356250 |
| Molecular Formula | C17H26N4O2S |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | tert-butyl 2-(carbamothioylamino)-4-(4-methylpiperazin-1-yl)benzoate |
| SMILES | CN1CCN(c2ccc(C(=O)OC(C)(C)C)c(NC(N)=S)c2)CC1 |
| InChI | InChI=1S/C17H26N4O2S/c1-17(2,3)23-15(22)13-6-5-12(11-14(13)19-16(18)24)21-9-7-20(4)8-10-21/h5-6,11H,7-10H2,1-4H3,(H3,18,19,24) |
| InChIKey | AYYXDSSWWQPOHG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|