C22H29N3O3 — CID 174612994
tert-butyl 2-anilino-4-(4-methylpiperazin-1-yl)benzenecarboperoxoate (PubChem CID 174612994) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is tert-butyl 2-anilino-4-(4-methylpiperazin-1-yl)benzenecarboperoxoate.
| Compound Name | tert-butyl 2-anilino-4-(4-methylpiperazin-1-yl)benzenecarboperoxoate |
|---|---|
| PubChem CID | 174612994 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | tert-butyl 2-anilino-4-(4-methylpiperazin-1-yl)benzenecarboperoxoate |
| SMILES | CN1CCN(c2ccc(C(=O)OOC(C)(C)C)c(Nc3ccccc3)c2)CC1 |
| InChI | InChI=1S/C22H29N3O3/c1-22(2,3)28-27-21(26)19-11-10-18(25-14-12-24(4)13-15-25)16-20(19)23-17-8-6-5-7-9-17/h5-11,16,23H,12-15H2,1-4H3 |
| InChIKey | KBKPDGMWHCUFJS-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|